C42H72N2O6 — CID 151973385
bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) benzene-1,2-dicarboxylate (PubChem CID 151973385) has the molecular formula C42H72N2O6 and a molecular weight of 701.05 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) benzene-1,2-dicarboxylate.
| Compound Name | bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 151973385 |
| Molecular Formula | C42H72N2O6 |
| Molecular Weight | 701.05 g/mol |
| Exact Mass | 700.54 |
| IUPAC Name | bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCON1C(C)(C)CC(OC(=O)c2ccccc2C(=O)OC2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C42H72N2O6/c1-11-13-15-17-19-23-27-47-43-39(3,4)29-33(30-40(43,5)6)49-37(45)35-25-21-22-26-36(35)38(46)50-34-31-41(7,8)44(42(9,10)32-34)48-28-24-20-18-16-14-12-2/h21-22,25-26,33-34H,11-20,23-24,27-32H2,1-10H3 |
| InChIKey | UBDOGRUNQZQSQY-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.05 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|