C27H45N3O4 — CID 19831358
N'-(2-ethoxyphenyl)-N-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxamide (PubChem CID 19831358) has the molecular formula C27H45N3O4 and a molecular weight of 475.67 g/mol. Its IUPAC name is N'-(2-ethoxyphenyl)-N-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxamide.
| Compound Name | N'-(2-ethoxyphenyl)-N-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 19831358 |
| Molecular Formula | C27H45N3O4 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.34 |
| IUPAC Name | N'-(2-ethoxyphenyl)-N-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxamide |
| SMILES | CCCCCCCCON1C(C)(C)CC(NC(=O)C(=O)Nc2ccccc2OCC)CC1(C)C |
| InChI | InChI=1S/C27H45N3O4/c1-7-9-10-11-12-15-18-34-30-26(3,4)19-21(20-27(30,5)6)28-24(31)25(32)29-22-16-13-14-17-23(22)33-8-2/h13-14,16-17,21H,7-12,15,18-20H2,1-6H3,(H,28,31)(H,29,32) |
| InChIKey | AEHQLWPWTNMPSF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|