C22H32O7 — CID 177499786
CID 177499786 (PubChem CID 177499786) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol.
| Compound Name | CID 177499786 |
|---|---|
| PubChem CID | 177499786 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OC1[C@@H]2OC3(CCCCC3)O[C@@H]2C(O)[C@@H]2OC3(CCCCC3)O[C@@H]12 |
| InChI | InChI=1S/C22H32O7/c1-13(2)20(24)25-17-18-15(26-21(28-18)9-5-3-6-10-21)14(23)16-19(17)29-22(27-16)11-7-4-8-12-22/h14-19,23H,1,3-12H2,2H3/t14?,15-,16+,17?,18-,19-/m1/s1 |
| InChIKey | SNJWSTSXXRGUIC-ZVPQGUEHSA-N |
| XLogP | 2.74 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|