C19H32O6 — CID 131971280
(1R,2S,3S,7S,8S,9S)-11,11-di(propan-2-yl)spiro[4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-5,1'-cyclohexane]-2,8-diol (PubChem CID 131971280) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is (1R,2S,3S,7S,8S,9S)-11,11-di(propan-2-yl)spiro[4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-5,1'-cyclohexane]-2,8-diol.
| Compound Name | (1R,2S,3S,7S,8S,9S)-11,11-di(propan-2-yl)spiro[4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-5,1'-cyclohexane]-2,8-diol |
|---|---|
| PubChem CID | 131971280 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (1R,2S,3S,7S,8S,9S)-11,11-di(propan-2-yl)spiro[4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-5,1'-cyclohexane]-2,8-diol |
| SMILES | CC(C)C1(C(C)C)O[C@@H]2[C@@H](O)[C@@H]3OC4(CCCCC4)O[C@H]3[C@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C19H32O6/c1-10(2)19(11(3)4)24-16-12(20)14-15(13(21)17(16)25-19)23-18(22-14)8-6-5-7-9-18/h10-17,20-21H,5-9H2,1-4H3/t12-,13-,14-,15-,16-,17+/m0/s1 |
| InChIKey | KYDIBXXIOYWBER-KBCNZALWSA-N |
| XLogP | 1.96 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |