C12H20O6 — CID 71315075
(4S,5S,7aR)-spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4,5,6,7-tetrol (PubChem CID 71315075) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (4S,5S,7aR)-spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4,5,6,7-tetrol.
| Compound Name | (4S,5S,7aR)-spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4,5,6,7-tetrol |
|---|---|
| PubChem CID | 71315075 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (4S,5S,7aR)-spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4,5,6,7-tetrol |
| SMILES | OC1C(O)[C@H](O)[C@H](O)C2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C12H20O6/c13-6-7(14)9(16)11-10(8(6)15)17-12(18-11)4-2-1-3-5-12/h6-11,13-16H,1-5H2/t6-,7?,8-,9?,10?,11+/m0/s1 |
| InChIKey | SOONKKMMJCQOLI-XSISKKHOSA-N |
| XLogP | -1.11 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |