C20H36O6 — CID 90243958
(3aR,5R,6S)-4,7-dibutoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5,6-diol (PubChem CID 90243958) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is (3aR,5R,6S)-4,7-dibutoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5,6-diol.
| Compound Name | (3aR,5R,6S)-4,7-dibutoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5,6-diol |
|---|---|
| PubChem CID | 90243958 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (3aR,5R,6S)-4,7-dibutoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5,6-diol |
| SMILES | CCCCOC1C2OC3(CCCCC3)O[C@@H]2C(OCCCC)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H36O6/c1-3-5-12-23-16-14(21)15(22)17(24-13-6-4-2)19-18(16)25-20(26-19)10-8-7-9-11-20/h14-19,21-22H,3-13H2,1-2H3/t14-,15+,16?,17?,18-,19?/m1/s1 |
| InChIKey | DJSUTSXFHRWOGR-ZZWJEXMISA-N |
| XLogP | 2.54 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|