C28H54O12P2 — CID 101271789
[(3aR,4S,5R,6R,7S,7aS)-7-dibutoxyphosphoryloxy-5,6-dihydroxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] dibutyl phosphate (PubChem CID 101271789) has the molecular formula C28H54O12P2 and a molecular weight of 644.68 g/mol. Its IUPAC name is [(3aR,4S,5R,6R,7S,7aS)-7-dibutoxyphosphoryloxy-5,6-dihydroxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] dibutyl phosphate.
| Compound Name | [(3aR,4S,5R,6R,7S,7aS)-7-dibutoxyphosphoryloxy-5,6-dihydroxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] dibutyl phosphate |
|---|---|
| PubChem CID | 101271789 |
| Molecular Formula | C28H54O12P2 |
| Molecular Weight | 644.68 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | [(3aR,4S,5R,6R,7S,7aS)-7-dibutoxyphosphoryloxy-5,6-dihydroxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] dibutyl phosphate |
| SMILES | CCCCOP(=O)(OCCCC)O[C@H]1[C@H](O)[C@@H](O)[C@H](OP(=O)(OCCCC)OCCCC)[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C28H54O12P2/c1-5-9-18-33-41(31,34-19-10-6-2)39-24-22(29)23(30)25(27-26(24)37-28(38-27)16-14-13-15-17-28)40-42(32,35-20-11-7-3)36-21-12-8-4/h22-27,29-30H,5-21H2,1-4H3/t22-,23-,24+,25+,26-,27+/m1/s1 |
| InChIKey | ANPXTWXWYOUDIX-RCZYFYQJSA-N |
| XLogP | 6.42 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|