C12H20O5 — CID 20744986
6-(1-hydroxyethyl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-ol (PubChem CID 20744986) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 6-(1-hydroxyethyl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-ol.
| Compound Name | 6-(1-hydroxyethyl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-ol |
|---|---|
| PubChem CID | 20744986 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 6-(1-hydroxyethyl)spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-ol |
| SMILES | CC(O)C1OC(O)C2OC3(CCCCC3)OC12 |
| InChI | InChI=1S/C12H20O5/c1-7(13)8-9-10(11(14)15-8)17-12(16-9)5-3-2-4-6-12/h7-11,13-14H,2-6H2,1H3 |
| InChIKey | XONNMHCEIZXLMV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |