C18H32O2 — CID 118144685
4,6-ditert-butylspiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclopentane] (PubChem CID 118144685) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 4,6-ditert-butylspiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclopentane].
| Compound Name | 4,6-ditert-butylspiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclopentane] |
|---|---|
| PubChem CID | 118144685 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 4,6-ditert-butylspiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclopentane] |
| SMILES | CC(C)(C)C1CC(C(C)(C)C)C2OC3(CCCC3)OC21 |
| InChI | InChI=1S/C18H32O2/c1-16(2,3)12-11-13(17(4,5)6)15-14(12)19-18(20-15)9-7-8-10-18/h12-15H,7-11H2,1-6H3 |
| InChIKey | ITIFFBMZNOUUFC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |