C25H46O4 — CID 145105354
1-(7-tert-butylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl)oxycyclohexan-1-ol;propane (PubChem CID 145105354) has the molecular formula C25H46O4 and a molecular weight of 410.64 g/mol. Its IUPAC name is 1-(7-tert-butylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl)oxycyclohexan-1-ol;propane.
| Compound Name | 1-(7-tert-butylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl)oxycyclohexan-1-ol;propane |
|---|---|
| PubChem CID | 145105354 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | 1-(7-tert-butylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl)oxycyclohexan-1-ol;propane |
| SMILES | CC(C)(C)C1CC(OC2(O)CCCCC2)CC2OC3(CCCCC3)OC21.CCC |
| InChI | InChI=1S/C22H38O4.C3H8/c1-20(2,3)17-14-16(24-21(23)10-6-4-7-11-21)15-18-19(17)26-22(25-18)12-8-5-9-13-22;1-3-2/h16-19,23H,4-15H2,1-3H3;3H2,1-2H3 |
| InChIKey | VWLKXCBEYOHZEC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|