C15H25NO6 — CID 10781624
N-[(3aS,4S,5S,6R,6aR)-6-hydroxy-4-(methoxymethoxy)spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl]acetamide (PubChem CID 10781624) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[(3aS,4S,5S,6R,6aR)-6-hydroxy-4-(methoxymethoxy)spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl]acetamide.
| Compound Name | N-[(3aS,4S,5S,6R,6aR)-6-hydroxy-4-(methoxymethoxy)spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl]acetamide |
|---|---|
| PubChem CID | 10781624 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[(3aS,4S,5S,6R,6aR)-6-hydroxy-4-(methoxymethoxy)spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl]acetamide |
| SMILES | COCO[C@H]1[C@@H](NC(C)=O)[C@@H](O)[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C15H25NO6/c1-9(17)16-10-11(18)13-14(12(10)20-8-19-2)22-15(21-13)6-4-3-5-7-15/h10-14,18H,3-8H2,1-2H3,(H,16,17)/t10-,11+,12-,13+,14-/m0/s1 |
| InChIKey | UFQDOFYDEMWHMQ-VJTDZRGJSA-N |
| XLogP | 0.30 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|