C14H20F3NO6S — CID 10715232
[(3aR,4S,5R,6aS)-4-acetamidospiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl] trifluoromethanesulfonate (PubChem CID 10715232) has the molecular formula C14H20F3NO6S and a molecular weight of 387.38 g/mol. Its IUPAC name is [(3aR,4S,5R,6aS)-4-acetamidospiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,4S,5R,6aS)-4-acetamidospiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10715232 |
| Molecular Formula | C14H20F3NO6S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | [(3aR,4S,5R,6aS)-4-acetamidospiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl] trifluoromethanesulfonate |
| SMILES | CC(=O)N[C@H]1[C@H]2OC3(CCCCC3)O[C@H]2C[C@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO6S/c1-8(19)18-11-9(24-25(20,21)14(15,16)17)7-10-12(11)23-13(22-10)5-3-2-4-6-13/h9-12H,2-7H2,1H3,(H,18,19)/t9-,10+,11-,12+/m1/s1 |
| InChIKey | NNXXGUBHYLOLNO-KXNHARMFSA-N |
| XLogP | 1.57 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|