C10H15F3O6S — CID 176697932
[(2R,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl] trifluoromethanesulfonate (PubChem CID 176697932) has the molecular formula C10H15F3O6S and a molecular weight of 320.29 g/mol. Its IUPAC name is [(2R,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176697932 |
| Molecular Formula | C10H15F3O6S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | [(2R,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)OC[C@H]([C@H]2OCC[C@H]2OS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C10H15F3O6S/c1-9(2)17-5-7(18-9)8-6(3-4-16-8)19-20(14,15)10(11,12)13/h6-8H,3-5H2,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | BRJXNKOBNHORFC-PRJMDXOYSA-N |
| XLogP | 1.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|