C13H26O5 — CID 143391198
2,2-dimethyl-4-(oxolan-2-yl)-1,3-dioxolane;2-methoxypropan-2-ol (PubChem CID 143391198) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2,2-dimethyl-4-(oxolan-2-yl)-1,3-dioxolane;2-methoxypropan-2-ol.
| Compound Name | 2,2-dimethyl-4-(oxolan-2-yl)-1,3-dioxolane;2-methoxypropan-2-ol |
|---|---|
| PubChem CID | 143391198 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2,2-dimethyl-4-(oxolan-2-yl)-1,3-dioxolane;2-methoxypropan-2-ol |
| SMILES | CC1(C)OCC(C2CCCO2)O1.COC(C)(C)O |
| InChI | InChI=1S/C9H16O3.C4H10O2/c1-9(2)11-6-8(12-9)7-4-3-5-10-7;1-4(2,5)6-3/h7-8H,3-6H2,1-2H3;5H,1-3H3 |
| InChIKey | QHRWSKNEUIUFPY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|