C12H20O5 — CID 98549014
(1S,5S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethyl-2,4-dioxabicyclo[3.1.1]heptan-1-ol (PubChem CID 98549014) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (1S,5S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethyl-2,4-dioxabicyclo[3.1.1]heptan-1-ol.
| Compound Name | (1S,5S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethyl-2,4-dioxabicyclo[3.1.1]heptan-1-ol |
|---|---|
| PubChem CID | 98549014 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (1S,5S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethyl-2,4-dioxabicyclo[3.1.1]heptan-1-ol |
| SMILES | CC1(C)OC[C@@H]([C@H]2[C@@H]3C[C@]2(O)OC(C)(C)O3)O1 |
| InChI | InChI=1S/C12H20O5/c1-10(2)14-6-8(16-10)9-7-5-12(9,13)17-11(3,4)15-7/h7-9,13H,5-6H2,1-4H3/t7-,8-,9+,12-/m0/s1 |
| InChIKey | KHDIMNQLVGLSCD-UOKLYIGXSA-N |
| XLogP | 1.00 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |