C9H16O4 — CID 131201511
[(2R,3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methanol (PubChem CID 131201511) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is [(2R,3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [(2R,3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 131201511 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [(2R,3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methanol |
| SMILES | CC1(C)OC[C@@H]([C@@H]2O[C@]2(C)CO)O1 |
| InChI | InChI=1S/C9H16O4/c1-8(2)11-4-6(12-8)7-9(3,5-10)13-7/h6-7,10H,4-5H2,1-3H3/t6-,7-,9+/m0/s1 |
| InChIKey | UNGPVHZMYXJHQE-ACLDMZEESA-N |
| XLogP | 0.29 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|