C13H23NO6 — CID 134975146
[(3aR,5S,6R,6aR)-6-amino-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methanol (PubChem CID 134975146) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-6-amino-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,5S,6R,6aR)-6-amino-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 134975146 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | [(3aR,5S,6R,6aR)-6-amino-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)OCC([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@@]2(N)CO)O1 |
| InChI | InChI=1S/C13H23NO6/c1-11(2)16-5-7(18-11)8-13(14,6-15)9-10(17-8)20-12(3,4)19-9/h7-10,15H,5-6,14H2,1-4H3/t7?,8-,9+,10-,13-/m1/s1 |
| InChIKey | NOSYZWNKCWKEHR-FPXOJLEASA-N |
| XLogP | -0.30 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |