C14H25N3O7 — CID 50990444
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-N'-hydroxy-6-[hydroxy(methyl)amino]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboximidamide (PubChem CID 50990444) has the molecular formula C14H25N3O7 and a molecular weight of 347.37 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-N'-hydroxy-6-[hydroxy(methyl)amino]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboximidamide.
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-N'-hydroxy-6-[hydroxy(methyl)amino]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboximidamide |
|---|---|
| PubChem CID | 50990444 |
| Molecular Formula | C14H25N3O7 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-N'-hydroxy-6-[hydroxy(methyl)amino]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboximidamide |
| SMILES | CN(O)C1(/C(N)=N/O)C(C2COC(C)(C)O2)OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C14H25N3O7/c1-12(2)20-6-7(22-12)8-14(17(5)19,11(15)16-18)9-10(21-8)24-13(3,4)23-9/h7-10,18-19H,6H2,1-5H3,(H2,15,16) |
| InChIKey | BSIWJBNURXPJCI-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|