C16H28O5 — CID 11243528
1-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxy-1-methylcyclohexyl]ethanone (PubChem CID 11243528) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxy-1-methylcyclohexyl]ethanone.
| Compound Name | 1-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxy-1-methylcyclohexyl]ethanone |
|---|---|
| PubChem CID | 11243528 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxy-1-methylcyclohexyl]ethanone |
| SMILES | COC1(OC)CC[C@@](C)(C(C)=O)[C@H]([C@H]2COC(C)(C)O2)C1 |
| InChI | InChI=1S/C16H28O5/c1-11(17)15(4)7-8-16(18-5,19-6)9-12(15)13-10-20-14(2,3)21-13/h12-13H,7-10H2,1-6H3/t12-,13+,15-/m0/s1 |
| InChIKey | XILFWPRDIDADMO-GUTXKFCHSA-N |
| XLogP | 2.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|