C9H15NO4 — CID 10559989
(4S)-2,2-dimethyl-4-[(1R,2R)-2-methyl-2-nitrocyclopropyl]-1,3-dioxolane (PubChem CID 10559989) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-[(1R,2R)-2-methyl-2-nitrocyclopropyl]-1,3-dioxolane.
| Compound Name | (4S)-2,2-dimethyl-4-[(1R,2R)-2-methyl-2-nitrocyclopropyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10559989 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (4S)-2,2-dimethyl-4-[(1R,2R)-2-methyl-2-nitrocyclopropyl]-1,3-dioxolane |
| SMILES | CC1(C)OC[C@H]([C@@H]2C[C@@]2(C)[N+](=O)[O-])O1 |
| InChI | InChI=1S/C9H15NO4/c1-8(2)13-5-7(14-8)6-4-9(6,3)10(11)12/h6-7H,4-5H2,1-3H3/t6-,7+,9+/m0/s1 |
| InChIKey | DCUSJRXEXPFYGZ-LKEWCRSYSA-N |
| XLogP | 1.19 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|