C9H15NO2 — CID 102471705
(2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,5-dihydro-1H-pyrrole (PubChem CID 102471705) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,5-dihydro-1H-pyrrole.
| Compound Name | (2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 102471705 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (2R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,5-dihydro-1H-pyrrole |
| SMILES | CC1(C)OC[C@@H]([C@H]2C=CCN2)O1 |
| InChI | InChI=1S/C9H15NO2/c1-9(2)11-6-8(12-9)7-4-3-5-10-7/h3-4,7-8,10H,5-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | MDEVNXFCVFWFNH-SFYZADRCSA-N |
| XLogP | 0.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|