C13H21NO4 — CID 10901221
(4S)-4-[(1R,6R)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10901221) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is (4S)-4-[(1R,6R)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(1R,6R)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10901221 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (4S)-4-[(1R,6R)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1=C(C)C[C@@H]([N+](=O)[O-])[C@H]([C@H]2COC(C)(C)O2)C1 |
| InChI | InChI=1S/C13H21NO4/c1-8-5-10(11(14(15)16)6-9(8)2)12-7-17-13(3,4)18-12/h10-12H,5-7H2,1-4H3/t10-,11-,12-/m1/s1 |
| InChIKey | KZJHMYJBPUUOJQ-IJLUTSLNSA-N |
| XLogP | 2.53 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|