C10H18O3 — CID 101076749
(4aS,9aR)-7,7-dimethyl-3,4,4a,5,9,9a-hexahydro-2H-pyrano[2,3-e][1,3]dioxepine (PubChem CID 101076749) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (4aS,9aR)-7,7-dimethyl-3,4,4a,5,9,9a-hexahydro-2H-pyrano[2,3-e][1,3]dioxepine.
| Compound Name | (4aS,9aR)-7,7-dimethyl-3,4,4a,5,9,9a-hexahydro-2H-pyrano[2,3-e][1,3]dioxepine |
|---|---|
| PubChem CID | 101076749 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (4aS,9aR)-7,7-dimethyl-3,4,4a,5,9,9a-hexahydro-2H-pyrano[2,3-e][1,3]dioxepine |
| SMILES | CC1(C)OC[C@@H]2CCCO[C@H]2CO1 |
| InChI | InChI=1S/C10H18O3/c1-10(2)12-6-8-4-3-5-11-9(8)7-13-10/h8-9H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | AIHOQQAVTSAGDR-IUCAKERBSA-N |
| XLogP | 1.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |