C20H38O7 — CID 20522440
2-cyclohexyl-1,4,7,10,13,16,19-heptaoxacyclohenicosane (PubChem CID 20522440) has the molecular formula C20H38O7 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-cyclohexyl-1,4,7,10,13,16,19-heptaoxacyclohenicosane.
| Compound Name | 2-cyclohexyl-1,4,7,10,13,16,19-heptaoxacyclohenicosane |
|---|---|
| PubChem CID | 20522440 |
| Molecular Formula | C20H38O7 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 2-cyclohexyl-1,4,7,10,13,16,19-heptaoxacyclohenicosane |
| SMILES | C1CCC(C2COCCOCCOCCOCCOCCOCCO2)CC1 |
| InChI | InChI=1S/C20H38O7/c1-2-4-19(5-3-1)20-18-26-15-14-24-11-10-22-7-6-21-8-9-23-12-13-25-16-17-27-20/h19-20H,1-18H2 |
| InChIKey | RUHRUMDCLJYLHI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |