C8H14O — CID 21122216
(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran (PubChem CID 21122216) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran.
| Compound Name | (3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
|---|---|
| PubChem CID | 21122216 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
| SMILES | C1CC[C@H]2OCC[C@@H]2C1 |
| InChI | InChI=1S/C8H14O/c1-2-4-8-7(3-1)5-6-9-8/h7-8H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | DNZWAKVIOXCEHH-JGVFFNPUSA-N |
| XLogP | 1.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |