C20H36O6 — CID 10959677
(1S,9R,14S,22R)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosane (PubChem CID 10959677) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is (1S,9R,14S,22R)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosane.
| Compound Name | (1S,9R,14S,22R)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosane |
|---|---|
| PubChem CID | 10959677 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (1S,9R,14S,22R)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosane |
| SMILES | C1CC[C@H]2OCCOCCO[C@H]3CCCC[C@H]3OCCOCCO[C@H]2C1 |
| InChI | InChI=1S/C20H36O6/c1-2-6-18-17(5-1)23-13-9-21-11-15-25-19-7-3-4-8-20(19)26-16-12-22-10-14-24-18/h17-20H,1-16H2/t17-,18+,19+,20- |
| InChIKey | BBGKDYHZQOSNMU-JVSBHGNQSA-N |
| XLogP | 2.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |