C10H18O3 — CID 174406152
1,4-dioxane;7-oxabicyclo[4.1.0]heptane (PubChem CID 174406152) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1,4-dioxane;7-oxabicyclo[4.1.0]heptane.
| Compound Name | 1,4-dioxane;7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 174406152 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 1,4-dioxane;7-oxabicyclo[4.1.0]heptane |
| SMILES | C1CCC2OC2C1.C1COCCO1 |
| InChI | InChI=1S/C6H10O.C4H8O2/c1-2-4-6-5(3-1)7-6;1-2-6-4-3-5-1/h5-6H,1-4H2;1-4H2 |
| InChIKey | BNRHJZDKMXQVLW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|