C9H14O2 — CID 7098824
(1S,4S,6R,10R)-5,11-dioxatricyclo[8.1.0.04,6]undecane (PubChem CID 7098824) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (1S,4S,6R,10R)-5,11-dioxatricyclo[8.1.0.04,6]undecane.
| Compound Name | (1S,4S,6R,10R)-5,11-dioxatricyclo[8.1.0.04,6]undecane |
|---|---|
| PubChem CID | 7098824 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (1S,4S,6R,10R)-5,11-dioxatricyclo[8.1.0.04,6]undecane |
| SMILES | C1C[C@H]2O[C@H]2CC[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C9H14O2/c1-2-6-8(10-6)4-5-9-7(3-1)11-9/h6-9H,1-5H2/t6-,7-,8+,9+/m1/s1 |
| InChIKey | HLGDWSHQZUFCJF-HXFLIBJXSA-N |
| XLogP | 1.49 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|