C4H6O — CID 98125749
(1S,4S)-5-oxabicyclo[2.1.0]pentane (PubChem CID 98125749) has the molecular formula C4H6O and a molecular weight of 70.09 g/mol. Its IUPAC name is (1S,4S)-5-oxabicyclo[2.1.0]pentane.
| Compound Name | (1S,4S)-5-oxabicyclo[2.1.0]pentane |
|---|---|
| PubChem CID | 98125749 |
| Molecular Formula | C4H6O |
| Molecular Weight | 70.09 g/mol |
| Exact Mass | 70.04 |
| IUPAC Name | (1S,4S)-5-oxabicyclo[2.1.0]pentane |
| SMILES | C1C[C@@H]2O[C@@H]12 |
| InChI | InChI=1S/C4H6O/c1-2-4-3(1)5-4/h3-4H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | BIMXFPIWUWKRHY-IMJSIDKUSA-N |
| XLogP | 0.55 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 70.09 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|