C9H13BrO — CID 13003783
(1R,4R,6S,9S)-10-bromo-5-oxatricyclo[7.1.0.04,6]decane (PubChem CID 13003783) has the molecular formula C9H13BrO and a molecular weight of 217.11 g/mol. Its IUPAC name is (1R,4R,6S,9S)-10-bromo-5-oxatricyclo[7.1.0.04,6]decane.
| Compound Name | (1R,4R,6S,9S)-10-bromo-5-oxatricyclo[7.1.0.04,6]decane |
|---|---|
| PubChem CID | 13003783 |
| Molecular Formula | C9H13BrO |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | (1R,4R,6S,9S)-10-bromo-5-oxatricyclo[7.1.0.04,6]decane |
| SMILES | BrC1[C@H]2CC[C@@H]3O[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C9H13BrO/c10-9-5-1-3-7-8(11-7)4-2-6(5)9/h5-9H,1-4H2/t5-,6+,7-,8+,9? |
| InChIKey | STCZPVWFJORWMF-USOQZRIPSA-N |
| XLogP | 2.34 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|