C6H8O2 — CID 15647432
3,8-dioxatricyclo[3.2.1.02,4]octane (PubChem CID 15647432) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is 3,8-dioxatricyclo[3.2.1.02,4]octane.
| Compound Name | 3,8-dioxatricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 15647432 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 3,8-dioxatricyclo[3.2.1.02,4]octane |
| SMILES | C1CC2OC1C1OC21 |
| InChI | InChI=1S/C6H8O2/c1-2-4-6-5(8-6)3(1)7-4/h3-6H,1-2H2 |
| InChIKey | KLBCNXTVEQUQDA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|