About 3,8-dioxatricyclo[3.2.1.02,4]octane
3,8-dioxatricyclo[3.2.1.02,4]octane (PubChem CID 15647432) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is 3,8-dioxatricyclo[3.2.1.02,4]octane.
Molecular Properties
| Compound Name | 3,8-dioxatricyclo[3.2.1.02,4]octane |
| PubChem CID | 15647432 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 3,8-dioxatricyclo[3.2.1.02,4]octane |
| SMILES | C1CC2OC1C1OC21 |
| InChI | InChI=1S/C6H8O2/c1-2-4-6-5(8-6)3(1)7-4/h3-6H,1-2H2 |
| InChIKey | KLBCNXTVEQUQDA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dioxatricyclo[3.2.1.02,4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dioxatricyclo[3.2.1.02,4]octane?
The IUPAC name of 3,8-dioxatricyclo[3.2.1.02,4]octane (CID 15647432) is 3,8-dioxatricyclo[3.2.1.02,4]octane.
What is the SMILES notation for 3,8-dioxatricyclo[3.2.1.02,4]octane?
The canonical SMILES for 3,8-dioxatricyclo[3.2.1.02,4]octane is C1CC2OC1C1OC21.
What is the InChIKey of 3,8-dioxatricyclo[3.2.1.02,4]octane?
The InChIKey is KLBCNXTVEQUQDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2/c1-2-4-6-5(8-6)3(1)7-4/h3-6H,1-2H2.
What are the key properties of 3,8-dioxatricyclo[3.2.1.02,4]octane?
3,8-dioxatricyclo[3.2.1.02,4]octane has a molecular weight of 112.13 g/mol, XLogP of 0.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dioxatricyclo[3.2.1.02,4]octane is sourced from PubChem (CID 15647432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).