C12H16O6 — CID 59502485
6,7-bis(oxiran-2-ylmethoxy)-3,8-dioxatricyclo[3.2.1.02,4]octane (PubChem CID 59502485) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 6,7-bis(oxiran-2-ylmethoxy)-3,8-dioxatricyclo[3.2.1.02,4]octane.
| Compound Name | 6,7-bis(oxiran-2-ylmethoxy)-3,8-dioxatricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 59502485 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 6,7-bis(oxiran-2-ylmethoxy)-3,8-dioxatricyclo[3.2.1.02,4]octane |
| SMILES | C1OC1COC1C(OCC2CO2)C2OC1C1OC21 |
| InChI | InChI=1S/C12H16O6/c1-5(13-1)3-15-7-8(16-4-6-2-14-6)10-12-11(18-12)9(7)17-10/h5-12H,1-4H2 |
| InChIKey | NTDOBWKXZSMGCX-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|