C24H44O2 — CID 20656027
2-[[2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylcyclohexyl)cyclohexyl]oxymethyl]oxirane (PubChem CID 20656027) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is 2-[[2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylcyclohexyl)cyclohexyl]oxymethyl]oxirane.
| Compound Name | 2-[[2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylcyclohexyl)cyclohexyl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 20656027 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | 2-[[2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylcyclohexyl)cyclohexyl]oxymethyl]oxirane |
| SMILES | CC1C(C)C(C)C(C2C(C)C(C)C(OCC3CO3)C(C)C2C)C(C)C1C |
| InChI | InChI=1S/C24H44O2/c1-12-13(2)15(4)22(16(5)14(12)3)23-17(6)19(8)24(20(9)18(23)7)26-11-21-10-25-21/h12-24H,10-11H2,1-9H3 |
| InChIKey | HHDLXLKPWAQZTR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|