C9H17NO — CID 10241032
(5aR,9aS)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,4]oxazepine (PubChem CID 10241032) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (5aR,9aS)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,4]oxazepine.
| Compound Name | (5aR,9aS)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,4]oxazepine |
|---|---|
| PubChem CID | 10241032 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (5aR,9aS)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[f][1,4]oxazepine |
| SMILES | C1CC[C@@H]2OCCNC[C@H]2C1 |
| InChI | InChI=1S/C9H17NO/c1-2-4-9-8(3-1)7-10-5-6-11-9/h8-10H,1-7H2/t8-,9+/m1/s1 |
| InChIKey | GCXXSWVREBIBFX-BDAKNGLRSA-N |
| XLogP | 1.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |