About 2-(oxan-4-yl)morpholine;hydrochloride
2-(oxan-4-yl)morpholine;hydrochloride (PubChem CID 139026622) has the molecular formula C9H18ClNO2
and a molecular weight of 207.70 g/mol. Its IUPAC name is 2-(oxan-4-yl)morpholine;hydrochloride.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)morpholine;hydrochloride |
| PubChem CID | 139026622 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-(oxan-4-yl)morpholine;hydrochloride |
| SMILES | C1COC(C2CCOCC2)CN1.Cl |
| InChI | InChI=1S/C9H17NO2.ClH/c1-4-11-5-2-8(1)9-7-10-3-6-12-9;/h8-10H,1-7H2;1H |
| InChIKey | VQNFUEFFJVUMFW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(oxan-4-yl)morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)morpholine;hydrochloride?
The IUPAC name of 2-(oxan-4-yl)morpholine;hydrochloride (CID 139026622) is 2-(oxan-4-yl)morpholine;hydrochloride.
What is the SMILES notation for 2-(oxan-4-yl)morpholine;hydrochloride?
The canonical SMILES for 2-(oxan-4-yl)morpholine;hydrochloride is C1COC(C2CCOCC2)CN1.Cl.
What is the InChIKey of 2-(oxan-4-yl)morpholine;hydrochloride?
The InChIKey is VQNFUEFFJVUMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.ClH/c1-4-11-5-2-8(1)9-7-10-3-6-12-9;/h8-10H,1-7H2;1H.
What are the key properties of 2-(oxan-4-yl)morpholine;hydrochloride?
2-(oxan-4-yl)morpholine;hydrochloride has a molecular weight of 207.70 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)morpholine;hydrochloride is sourced from PubChem (CID 139026622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).