C12H24N2O2 — CID 116910867
N,N-dimethyl-1-morpholin-2-yl-1-(oxan-4-yl)methanamine (PubChem CID 116910867) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N,N-dimethyl-1-morpholin-2-yl-1-(oxan-4-yl)methanamine.
| Compound Name | N,N-dimethyl-1-morpholin-2-yl-1-(oxan-4-yl)methanamine |
|---|---|
| PubChem CID | 116910867 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N,N-dimethyl-1-morpholin-2-yl-1-(oxan-4-yl)methanamine |
| SMILES | CN(C)C(C1CCOCC1)C1CNCCO1 |
| InChI | InChI=1S/C12H24N2O2/c1-14(2)12(10-3-6-15-7-4-10)11-9-13-5-8-16-11/h10-13H,3-9H2,1-2H3 |
| InChIKey | DQPGHZXUXHGNTO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |