C12H25ClN2O2 — CID 53484266
2-(1,4-oxazocan-2-yl)-1,4-oxazocane;hydrochloride (PubChem CID 53484266) has the molecular formula C12H25ClN2O2 and a molecular weight of 264.80 g/mol. Its IUPAC name is 2-(1,4-oxazocan-2-yl)-1,4-oxazocane;hydrochloride.
| Compound Name | 2-(1,4-oxazocan-2-yl)-1,4-oxazocane;hydrochloride |
|---|---|
| PubChem CID | 53484266 |
| Molecular Formula | C12H25ClN2O2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-(1,4-oxazocan-2-yl)-1,4-oxazocane;hydrochloride |
| SMILES | C1CCOC(C2CNCCCCO2)CNC1.Cl |
| InChI | InChI=1S/C12H24N2O2.ClH/c1-3-7-15-11(9-13-5-1)12-10-14-6-2-4-8-16-12;/h11-14H,1-10H2;1H |
| InChIKey | XVPUKTVLOPWXHJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |