C18H38N2Si — CID 158507793
bis(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline);silane (PubChem CID 158507793) has the molecular formula C18H38N2Si and a molecular weight of 310.60 g/mol. Its IUPAC name is bis(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline);silane.
| Compound Name | bis(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline);silane |
|---|---|
| PubChem CID | 158507793 |
| Molecular Formula | C18H38N2Si |
| Molecular Weight | 310.60 g/mol |
| Exact Mass | 310.28 |
| IUPAC Name | bis(1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline);silane |
| SMILES | C1CCC2CNCCC2C1.C1CCC2CNCCC2C1.[SiH4] |
| InChI | InChI=1S/2C9H17N.H4Si/c2*1-2-4-9-7-10-6-5-8(9)3-1;/h2*8-10H,1-7H2;1H4 |
| InChIKey | HKRCCSVGBDRKKT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|