About 3-cyclohexylpyrrolidine;methanethioamide
3-cyclohexylpyrrolidine;methanethioamide (PubChem CID 161183886) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is 3-cyclohexylpyrrolidine;methanethioamide.
Molecular Properties
| Compound Name | 3-cyclohexylpyrrolidine;methanethioamide |
| PubChem CID | 161183886 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3-cyclohexylpyrrolidine;methanethioamide |
| SMILES | C1CCC(C2CCNC2)CC1.NC=S |
| InChI | InChI=1S/C10H19N.CH3NS/c1-2-4-9(5-3-1)10-6-7-11-8-10;2-1-3/h9-11H,1-8H2;1H,(H2,2,3) |
| InChIKey | USVHOTOJURYDEG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexylpyrrolidine;methanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylpyrrolidine;methanethioamide?
The IUPAC name of 3-cyclohexylpyrrolidine;methanethioamide (CID 161183886) is 3-cyclohexylpyrrolidine;methanethioamide.
What is the SMILES notation for 3-cyclohexylpyrrolidine;methanethioamide?
The canonical SMILES for 3-cyclohexylpyrrolidine;methanethioamide is C1CCC(C2CCNC2)CC1.NC=S.
What is the InChIKey of 3-cyclohexylpyrrolidine;methanethioamide?
The InChIKey is USVHOTOJURYDEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N.CH3NS/c1-2-4-9(5-3-1)10-6-7-11-8-10;2-1-3/h9-11H,1-8H2;1H,(H2,2,3).
What are the key properties of 3-cyclohexylpyrrolidine;methanethioamide?
3-cyclohexylpyrrolidine;methanethioamide has a molecular weight of 214.38 g/mol, XLogP of 2.08, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylpyrrolidine;methanethioamide is sourced from PubChem (CID 161183886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).