C11H23N — CID 142260650
1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;ethane (PubChem CID 142260650) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;ethane.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;ethane |
|---|---|
| PubChem CID | 142260650 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;ethane |
| SMILES | C1CCC2CNCCC2C1.CC |
| InChI | InChI=1S/C9H17N.C2H6/c1-2-4-9-7-10-6-5-8(9)3-1;1-2/h8-10H,1-7H2;1-2H3 |
| InChIKey | SYYMYSGLZGARAV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |