(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid

C10H19NO2 — CID 143297207

IUPAC(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid
SMILESC1CC[C@@H]2CNCCC2C1.O=CO
InChIInChI=1S/C9H17N.CH2O2/c1-2-4-9-7-10-6-5-8(9)3-1;2-1-3/h8-10H,1-7H2;1H,(H,2,3)/t8?,9-;/m1./s1
InChIKeyOVXJEUQZDVUNAF-ICLMXVQUSA-N
MW185.27 g/mol
LogP1.49
Rot. Bonds

About (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid

(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid (PubChem CID 143297207) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid.

Molecular Properties

Compound Name(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid
PubChem CID143297207
Molecular FormulaC10H19NO2
Molecular Weight185.27 g/mol
Exact Mass185.14
IUPAC Name(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid
SMILESC1CC[C@@H]2CNCCC2C1.O=CO
InChIInChI=1S/C9H17N.CH2O2/c1-2-4-9-7-10-6-5-8(9)3-1;2-1-3/h8-10H,1-7H2;1H,(H,2,3)/t8?,9-;/m1./s1
InChIKeyOVXJEUQZDVUNAF-ICLMXVQUSA-N
XLogP1.49
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.27
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid?
The IUPAC name of (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid (CID 143297207) is (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid.
What is the SMILES notation for (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid?
The canonical SMILES for (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid is C1CC[C@@H]2CNCCC2C1.O=CO.
What is the InChIKey of (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid?
The InChIKey is OVXJEUQZDVUNAF-ICLMXVQUSA-N. The full InChI is InChI=1S/C9H17N.CH2O2/c1-2-4-9-7-10-6-5-8(9)3-1;2-1-3/h8-10H,1-7H2;1H,(H,2,3)/t8?,9-;/m1./s1.
What are the key properties of (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid?
(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid has a molecular weight of 185.27 g/mol, XLogP of 1.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid is sourced from PubChem (CID 143297207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).