C10H19NO2 — CID 143297207
(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid (PubChem CID 143297207) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid.
| Compound Name | (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid |
|---|---|
| PubChem CID | 143297207 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formic acid |
| SMILES | C1CC[C@@H]2CNCCC2C1.O=CO |
| InChI | InChI=1S/C9H17N.CH2O2/c1-2-4-9-7-10-6-5-8(9)3-1;2-1-3/h8-10H,1-7H2;1H,(H,2,3)/t8?,9-;/m1./s1 |
| InChIKey | OVXJEUQZDVUNAF-ICLMXVQUSA-N |
| XLogP | 1.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|