C8H16N2 — CID 5255831
1,2,3,4,4a,5,6,7,8,8a-decahydro-2,6-naphthyridine (PubChem CID 5255831) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydro-2,6-naphthyridine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydro-2,6-naphthyridine |
|---|---|
| PubChem CID | 5255831 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydro-2,6-naphthyridine |
| SMILES | C1CC2CNCCC2CN1 |
| InChI | InChI=1S/C8H16N2/c1-3-9-6-8-2-4-10-5-7(1)8/h7-10H,1-6H2 |
| InChIKey | RXYRNRQEFMJQOV-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |