About 6-(4-methylcyclohexyl)-1,4-diazocane
6-(4-methylcyclohexyl)-1,4-diazocane (PubChem CID 138509045) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 6-(4-methylcyclohexyl)-1,4-diazocane.
Molecular Properties
| Compound Name | 6-(4-methylcyclohexyl)-1,4-diazocane |
| PubChem CID | 138509045 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 6-(4-methylcyclohexyl)-1,4-diazocane |
| SMILES | CC1CCC(C2CCNCCNC2)CC1 |
| InChI | InChI=1S/C13H26N2/c1-11-2-4-12(5-3-11)13-6-7-14-8-9-15-10-13/h11-15H,2-10H2,1H3 |
| InChIKey | GTJPFCBQAHUDSH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-methylcyclohexyl)-1,4-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methylcyclohexyl)-1,4-diazocane?
The IUPAC name of 6-(4-methylcyclohexyl)-1,4-diazocane (CID 138509045) is 6-(4-methylcyclohexyl)-1,4-diazocane.
What is the SMILES notation for 6-(4-methylcyclohexyl)-1,4-diazocane?
The canonical SMILES for 6-(4-methylcyclohexyl)-1,4-diazocane is CC1CCC(C2CCNCCNC2)CC1.
What is the InChIKey of 6-(4-methylcyclohexyl)-1,4-diazocane?
The InChIKey is GTJPFCBQAHUDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-11-2-4-12(5-3-11)13-6-7-14-8-9-15-10-13/h11-15H,2-10H2,1H3.
What are the key properties of 6-(4-methylcyclohexyl)-1,4-diazocane?
6-(4-methylcyclohexyl)-1,4-diazocane has a molecular weight of 210.36 g/mol, XLogP of 2.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methylcyclohexyl)-1,4-diazocane is sourced from PubChem (CID 138509045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).