C13H26N2 — CID 138509045
6-(4-methylcyclohexyl)-1,4-diazocane (PubChem CID 138509045) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 6-(4-methylcyclohexyl)-1,4-diazocane.
| Compound Name | 6-(4-methylcyclohexyl)-1,4-diazocane |
|---|---|
| PubChem CID | 138509045 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 6-(4-methylcyclohexyl)-1,4-diazocane |
| SMILES | CC1CCC(C2CCNCCNC2)CC1 |
| InChI | InChI=1S/C13H26N2/c1-11-2-4-12(5-3-11)13-6-7-14-8-9-15-10-13/h11-15H,2-10H2,1H3 |
| InChIKey | GTJPFCBQAHUDSH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |