C11H24N2O — CID 143297123
1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formamide;methane (PubChem CID 143297123) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formamide;methane.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formamide;methane |
|---|---|
| PubChem CID | 143297123 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline;formamide;methane |
| SMILES | C.C1CCC2CNCCC2C1.NC=O |
| InChI | InChI=1S/C9H17N.CH3NO.CH4/c1-2-4-9-7-10-6-5-8(9)3-1;2-1-3;/h8-10H,1-7H2;1H,(H2,2,3);1H4 |
| InChIKey | UCISKVGGBOVPSL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|