About 2-morpholin-2-ylthiolane 1-oxide
2-morpholin-2-ylthiolane 1-oxide (PubChem CID 173051110) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-morpholin-2-ylthiolane 1-oxide.
Molecular Properties
| Compound Name | 2-morpholin-2-ylthiolane 1-oxide |
| PubChem CID | 173051110 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-morpholin-2-ylthiolane 1-oxide |
| SMILES | O=S1CCCC1C1CNCCO1 |
| InChI | InChI=1S/C8H15NO2S/c10-12-5-1-2-8(12)7-6-9-3-4-11-7/h7-9H,1-6H2 |
| InChIKey | ABFWQUVDETTWJI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-morpholin-2-ylthiolane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-2-ylthiolane 1-oxide?
The IUPAC name of 2-morpholin-2-ylthiolane 1-oxide (CID 173051110) is 2-morpholin-2-ylthiolane 1-oxide.
What is the SMILES notation for 2-morpholin-2-ylthiolane 1-oxide?
The canonical SMILES for 2-morpholin-2-ylthiolane 1-oxide is O=S1CCCC1C1CNCCO1.
What is the InChIKey of 2-morpholin-2-ylthiolane 1-oxide?
The InChIKey is ABFWQUVDETTWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S/c10-12-5-1-2-8(12)7-6-9-3-4-11-7/h7-9H,1-6H2.
What are the key properties of 2-morpholin-2-ylthiolane 1-oxide?
2-morpholin-2-ylthiolane 1-oxide has a molecular weight of 189.28 g/mol, XLogP of -0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-2-ylthiolane 1-oxide is sourced from PubChem (CID 173051110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).