About cyclobutyl morpholine-2-carboxylate
cyclobutyl morpholine-2-carboxylate (PubChem CID 62217575) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is cyclobutyl morpholine-2-carboxylate.
Molecular Properties
| Compound Name | cyclobutyl morpholine-2-carboxylate |
| PubChem CID | 62217575 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | cyclobutyl morpholine-2-carboxylate |
| SMILES | O=C(OC1CCC1)C1CNCCO1 |
| InChI | InChI=1S/C9H15NO3/c11-9(13-7-2-1-3-7)8-6-10-4-5-12-8/h7-8,10H,1-6H2 |
| InChIKey | YQUHIBUYBOKIEG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclobutyl morpholine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl morpholine-2-carboxylate?
The IUPAC name of cyclobutyl morpholine-2-carboxylate (CID 62217575) is cyclobutyl morpholine-2-carboxylate.
What is the SMILES notation for cyclobutyl morpholine-2-carboxylate?
The canonical SMILES for cyclobutyl morpholine-2-carboxylate is O=C(OC1CCC1)C1CNCCO1.
What is the InChIKey of cyclobutyl morpholine-2-carboxylate?
The InChIKey is YQUHIBUYBOKIEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c11-9(13-7-2-1-3-7)8-6-10-4-5-12-8/h7-8,10H,1-6H2.
What are the key properties of cyclobutyl morpholine-2-carboxylate?
cyclobutyl morpholine-2-carboxylate has a molecular weight of 185.22 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl morpholine-2-carboxylate is sourced from PubChem (CID 62217575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).