ethane;morpholine-2-carboxylic acid

C7H15NO3 — CID 170608685

IUPACethane;morpholine-2-carboxylic acid
SMILESCC.O=C(O)C1CNCCO1
InChIInChI=1S/C5H9NO3.C2H6/c7-5(8)4-3-6-1-2-9-4;1-2/h4,6H,1-3H2,(H,7,8);1-2H3
InChIKeyKMMXZZLGKAMIAD-UHFFFAOYSA-N
MW161.20 g/mol
LogP0.09
Rot. Bonds1

About ethane;morpholine-2-carboxylic acid

ethane;morpholine-2-carboxylic acid (PubChem CID 170608685) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is ethane;morpholine-2-carboxylic acid.

Molecular Properties

Compound Nameethane;morpholine-2-carboxylic acid
PubChem CID170608685
Molecular FormulaC7H15NO3
Molecular Weight161.20 g/mol
Exact Mass161.11
IUPAC Nameethane;morpholine-2-carboxylic acid
SMILESCC.O=C(O)C1CNCCO1
InChIInChI=1S/C5H9NO3.C2H6/c7-5(8)4-3-6-1-2-9-4;1-2/h4,6H,1-3H2,(H,7,8);1-2H3
InChIKeyKMMXZZLGKAMIAD-UHFFFAOYSA-N
XLogP0.09
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.20
LogP ≤ 50.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze ethane;morpholine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;morpholine-2-carboxylic acid?
The IUPAC name of ethane;morpholine-2-carboxylic acid (CID 170608685) is ethane;morpholine-2-carboxylic acid.
What is the SMILES notation for ethane;morpholine-2-carboxylic acid?
The canonical SMILES for ethane;morpholine-2-carboxylic acid is CC.O=C(O)C1CNCCO1.
What is the InChIKey of ethane;morpholine-2-carboxylic acid?
The InChIKey is KMMXZZLGKAMIAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3.C2H6/c7-5(8)4-3-6-1-2-9-4;1-2/h4,6H,1-3H2,(H,7,8);1-2H3.
What are the key properties of ethane;morpholine-2-carboxylic acid?
ethane;morpholine-2-carboxylic acid has a molecular weight of 161.20 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;morpholine-2-carboxylic acid is sourced from PubChem (CID 170608685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).