About ethane;1-morpholin-2-ylethanone
ethane;1-morpholin-2-ylethanone (PubChem CID 143224838) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is ethane;1-morpholin-2-ylethanone.
Molecular Properties
| Compound Name | ethane;1-morpholin-2-ylethanone |
| PubChem CID | 143224838 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | ethane;1-morpholin-2-ylethanone |
| SMILES | CC.CC.CC(=O)C1CNCCO1 |
| InChI | InChI=1S/C6H11NO2.2C2H6/c1-5(8)6-4-7-2-3-9-6;2*1-2/h6-7H,2-4H2,1H3;2*1-2H3 |
| InChIKey | BIVOFBABXSISNM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-morpholin-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-morpholin-2-ylethanone?
The IUPAC name of ethane;1-morpholin-2-ylethanone (CID 143224838) is ethane;1-morpholin-2-ylethanone.
What is the SMILES notation for ethane;1-morpholin-2-ylethanone?
The canonical SMILES for ethane;1-morpholin-2-ylethanone is CC.CC.CC(=O)C1CNCCO1.
What is the InChIKey of ethane;1-morpholin-2-ylethanone?
The InChIKey is BIVOFBABXSISNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.2C2H6/c1-5(8)6-4-7-2-3-9-6;2*1-2/h6-7H,2-4H2,1H3;2*1-2H3.
What are the key properties of ethane;1-morpholin-2-ylethanone?
ethane;1-morpholin-2-ylethanone has a molecular weight of 189.30 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-morpholin-2-ylethanone is sourced from PubChem (CID 143224838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).