About ethyl morpholine-2-carboxylate;dihydrochloride
ethyl morpholine-2-carboxylate;dihydrochloride (PubChem CID 127258967) has the molecular formula C7H15Cl2NO3
and a molecular weight of 232.11 g/mol. Its IUPAC name is ethyl morpholine-2-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | ethyl morpholine-2-carboxylate;dihydrochloride |
| PubChem CID | 127258967 |
| Molecular Formula | C7H15Cl2NO3 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | ethyl morpholine-2-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)C1CNCCO1.Cl.Cl |
| InChI | InChI=1S/C7H13NO3.2ClH/c1-2-10-7(9)6-5-8-3-4-11-6;;/h6,8H,2-5H2,1H3;2*1H |
| InChIKey | SFFPLRWDYFBMSY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl morpholine-2-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl morpholine-2-carboxylate;dihydrochloride?
The IUPAC name of ethyl morpholine-2-carboxylate;dihydrochloride (CID 127258967) is ethyl morpholine-2-carboxylate;dihydrochloride.
What is the SMILES notation for ethyl morpholine-2-carboxylate;dihydrochloride?
The canonical SMILES for ethyl morpholine-2-carboxylate;dihydrochloride is CCOC(=O)C1CNCCO1.Cl.Cl.
What is the InChIKey of ethyl morpholine-2-carboxylate;dihydrochloride?
The InChIKey is SFFPLRWDYFBMSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3.2ClH/c1-2-10-7(9)6-5-8-3-4-11-6;;/h6,8H,2-5H2,1H3;2*1H.
What are the key properties of ethyl morpholine-2-carboxylate;dihydrochloride?
ethyl morpholine-2-carboxylate;dihydrochloride has a molecular weight of 232.11 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl morpholine-2-carboxylate;dihydrochloride is sourced from PubChem (CID 127258967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).