About cyclohexylmethyl morpholine-2-carboxylate
cyclohexylmethyl morpholine-2-carboxylate (PubChem CID 62382529) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is cyclohexylmethyl morpholine-2-carboxylate.
Molecular Properties
| Compound Name | cyclohexylmethyl morpholine-2-carboxylate |
| PubChem CID | 62382529 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | cyclohexylmethyl morpholine-2-carboxylate |
| SMILES | O=C(OCC1CCCCC1)C1CNCCO1 |
| InChI | InChI=1S/C12H21NO3/c14-12(11-8-13-6-7-15-11)16-9-10-4-2-1-3-5-10/h10-11,13H,1-9H2 |
| InChIKey | BGCBXNPYZUTWPW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexylmethyl morpholine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl morpholine-2-carboxylate?
The IUPAC name of cyclohexylmethyl morpholine-2-carboxylate (CID 62382529) is cyclohexylmethyl morpholine-2-carboxylate.
What is the SMILES notation for cyclohexylmethyl morpholine-2-carboxylate?
The canonical SMILES for cyclohexylmethyl morpholine-2-carboxylate is O=C(OCC1CCCCC1)C1CNCCO1.
What is the InChIKey of cyclohexylmethyl morpholine-2-carboxylate?
The InChIKey is BGCBXNPYZUTWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c14-12(11-8-13-6-7-15-11)16-9-10-4-2-1-3-5-10/h10-11,13H,1-9H2.
What are the key properties of cyclohexylmethyl morpholine-2-carboxylate?
cyclohexylmethyl morpholine-2-carboxylate has a molecular weight of 227.30 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl morpholine-2-carboxylate is sourced from PubChem (CID 62382529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).